C14H19BrN2OS2 — CID 62544442
N-[(4-bromothiophen-2-yl)-(4-ethyl-5-methyl-1,3-thiazol-2-yl)methyl]-2-methoxyethanamine (PubChem CID 62544442) has the molecular formula C14H19BrN2OS2 and a molecular weight of 375.36 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)-(4-ethyl-5-methyl-1,3-thiazol-2-yl)methyl]-2-methoxyethanamine.
| Compound Name | N-[(4-bromothiophen-2-yl)-(4-ethyl-5-methyl-1,3-thiazol-2-yl)methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 62544442 |
| Molecular Formula | C14H19BrN2OS2 |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)-(4-ethyl-5-methyl-1,3-thiazol-2-yl)methyl]-2-methoxyethanamine |
| SMILES | CCc1nc(C(NCCOC)c2cc(Br)cs2)sc1C |
| InChI | InChI=1S/C14H19BrN2OS2/c1-4-11-9(2)20-14(17-11)13(16-5-6-18-3)12-7-10(15)8-19-12/h7-8,13,16H,4-6H2,1-3H3 |
| InChIKey | IGNLZIFJQULEFZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|