C15H15N3OS — CID 62562895
3-[2-(3-methylanilino)ethyl]thieno[3,2-d]pyrimidin-4-one (PubChem CID 62562895) has the molecular formula C15H15N3OS and a molecular weight of 285.37 g/mol. Its IUPAC name is 3-[2-(3-methylanilino)ethyl]thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-[2-(3-methylanilino)ethyl]thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 62562895 |
| Molecular Formula | C15H15N3OS |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 3-[2-(3-methylanilino)ethyl]thieno[3,2-d]pyrimidin-4-one |
| SMILES | Cc1cccc(NCCn2cnc3ccsc3c2=O)c1 |
| InChI | InChI=1S/C15H15N3OS/c1-11-3-2-4-12(9-11)16-6-7-18-10-17-13-5-8-20-14(13)15(18)19/h2-5,8-10,16H,6-7H2,1H3 |
| InChIKey | HNSOUPCGFFUJOY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |