C12H12F4N2 — CID 62564083
2,2,2-trifluoro-N-[2-(6-fluoroindol-1-yl)ethyl]ethanamine (PubChem CID 62564083) has the molecular formula C12H12F4N2 and a molecular weight of 260.23 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-(6-fluoroindol-1-yl)ethyl]ethanamine.
| Compound Name | 2,2,2-trifluoro-N-[2-(6-fluoroindol-1-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 62564083 |
| Molecular Formula | C12H12F4N2 |
| Molecular Weight | 260.23 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-(6-fluoroindol-1-yl)ethyl]ethanamine |
| SMILES | Fc1ccc2ccn(CCNCC(F)(F)F)c2c1 |
| InChI | InChI=1S/C12H12F4N2/c13-10-2-1-9-3-5-18(11(9)7-10)6-4-17-8-12(14,15)16/h1-3,5,7,17H,4,6,8H2 |
| InChIKey | SLAFNSSFYHDLDY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.23 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|