C13H16ClNO — CID 62571552
2-(4-chloro-2-methylphenoxy)-N-prop-2-ynylpropan-1-amine (PubChem CID 62571552) has the molecular formula C13H16ClNO and a molecular weight of 237.73 g/mol. Its IUPAC name is 2-(4-chloro-2-methylphenoxy)-N-prop-2-ynylpropan-1-amine.
| Compound Name | 2-(4-chloro-2-methylphenoxy)-N-prop-2-ynylpropan-1-amine |
|---|---|
| PubChem CID | 62571552 |
| Molecular Formula | C13H16ClNO |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 2-(4-chloro-2-methylphenoxy)-N-prop-2-ynylpropan-1-amine |
| SMILES | C#CCNCC(C)Oc1ccc(Cl)cc1C |
| InChI | InChI=1S/C13H16ClNO/c1-4-7-15-9-11(3)16-13-6-5-12(14)8-10(13)2/h1,5-6,8,11,15H,7,9H2,2-3H3 |
| InChIKey | LAGUECIORKCPMZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|