C15H20BrNO — CID 115402823
2-(4-bromo-2-propan-2-ylphenoxy)-N-prop-2-ynylpropan-1-amine (PubChem CID 115402823) has the molecular formula C15H20BrNO and a molecular weight of 310.24 g/mol. Its IUPAC name is 2-(4-bromo-2-propan-2-ylphenoxy)-N-prop-2-ynylpropan-1-amine.
| Compound Name | 2-(4-bromo-2-propan-2-ylphenoxy)-N-prop-2-ynylpropan-1-amine |
|---|---|
| PubChem CID | 115402823 |
| Molecular Formula | C15H20BrNO |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 2-(4-bromo-2-propan-2-ylphenoxy)-N-prop-2-ynylpropan-1-amine |
| SMILES | C#CCNCC(C)Oc1ccc(Br)cc1C(C)C |
| InChI | InChI=1S/C15H20BrNO/c1-5-8-17-10-12(4)18-15-7-6-13(16)9-14(15)11(2)3/h1,6-7,9,11-12,17H,8,10H2,2-4H3 |
| InChIKey | DGPDIZBLWJURFU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|