C13H15Br2NO2 — CID 79403408
2-(2,5-dibromo-4-methoxyphenoxy)-N-prop-2-ynylpropan-1-amine (PubChem CID 79403408) has the molecular formula C13H15Br2NO2 and a molecular weight of 377.08 g/mol. Its IUPAC name is 2-(2,5-dibromo-4-methoxyphenoxy)-N-prop-2-ynylpropan-1-amine.
| Compound Name | 2-(2,5-dibromo-4-methoxyphenoxy)-N-prop-2-ynylpropan-1-amine |
|---|---|
| PubChem CID | 79403408 |
| Molecular Formula | C13H15Br2NO2 |
| Molecular Weight | 377.08 g/mol |
| Exact Mass | 374.95 |
| IUPAC Name | 2-(2,5-dibromo-4-methoxyphenoxy)-N-prop-2-ynylpropan-1-amine |
| SMILES | C#CCNCC(C)Oc1cc(Br)c(OC)cc1Br |
| InChI | InChI=1S/C13H15Br2NO2/c1-4-5-16-8-9(2)18-13-7-10(14)12(17-3)6-11(13)15/h1,6-7,9,16H,5,8H2,2-3H3 |
| InChIKey | XLHMSWTUZKNBEN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.08 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|