C12H13F2NO — CID 62572544
2-(2,4-difluorophenoxy)-N-prop-2-ynylpropan-1-amine (PubChem CID 62572544) has the molecular formula C12H13F2NO and a molecular weight of 225.24 g/mol. Its IUPAC name is 2-(2,4-difluorophenoxy)-N-prop-2-ynylpropan-1-amine.
| Compound Name | 2-(2,4-difluorophenoxy)-N-prop-2-ynylpropan-1-amine |
|---|---|
| PubChem CID | 62572544 |
| Molecular Formula | C12H13F2NO |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2-(2,4-difluorophenoxy)-N-prop-2-ynylpropan-1-amine |
| SMILES | C#CCNCC(C)Oc1ccc(F)cc1F |
| InChI | InChI=1S/C12H13F2NO/c1-3-6-15-8-9(2)16-12-5-4-10(13)7-11(12)14/h1,4-5,7,9,15H,6,8H2,2H3 |
| InChIKey | YKWMJTRIWGOHEC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|