C12H14F2N2O — CID 64727389
2-amino-4-(2,4-difluorophenoxy)-2-methylpentanenitrile (PubChem CID 64727389) has the molecular formula C12H14F2N2O and a molecular weight of 240.25 g/mol. Its IUPAC name is 2-amino-4-(2,4-difluorophenoxy)-2-methylpentanenitrile.
| Compound Name | 2-amino-4-(2,4-difluorophenoxy)-2-methylpentanenitrile |
|---|---|
| PubChem CID | 64727389 |
| Molecular Formula | C12H14F2N2O |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 2-amino-4-(2,4-difluorophenoxy)-2-methylpentanenitrile |
| SMILES | CC(CC(C)(N)C#N)Oc1ccc(F)cc1F |
| InChI | InChI=1S/C12H14F2N2O/c1-8(6-12(2,16)7-15)17-11-4-3-9(13)5-10(11)14/h3-5,8H,6,16H2,1-2H3 |
| InChIKey | ABVKLHCUKOBLOS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |