C8H15N3OS2 — CID 62576429
N-(2-methoxyethyl)-2-(1,3,4-thiadiazol-2-ylsulfanyl)propan-1-amine (PubChem CID 62576429) has the molecular formula C8H15N3OS2 and a molecular weight of 233.36 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-(1,3,4-thiadiazol-2-ylsulfanyl)propan-1-amine.
| Compound Name | N-(2-methoxyethyl)-2-(1,3,4-thiadiazol-2-ylsulfanyl)propan-1-amine |
|---|---|
| PubChem CID | 62576429 |
| Molecular Formula | C8H15N3OS2 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | N-(2-methoxyethyl)-2-(1,3,4-thiadiazol-2-ylsulfanyl)propan-1-amine |
| SMILES | COCCNCC(C)Sc1nncs1 |
| InChI | InChI=1S/C8H15N3OS2/c1-7(5-9-3-4-12-2)14-8-11-10-6-13-8/h6-7,9H,3-5H2,1-2H3 |
| InChIKey | WENLTTNKQQAADS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|