About 1-[5-(2-methoxyethyl)-1,2,4-oxadiazol-3-yl]ethanamine
1-[5-(2-methoxyethyl)-1,2,4-oxadiazol-3-yl]ethanamine (PubChem CID 62589330) has the molecular formula C7H13N3O2
and a molecular weight of 171.20 g/mol. Its IUPAC name is 1-[5-(2-methoxyethyl)-1,2,4-oxadiazol-3-yl]ethanamine.
Analyze 1-[5-(2-methoxyethyl)-1,2,4-oxadiazol-3-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(2-methoxyethyl)-1,2,4-oxadiazol-3-yl]ethanamine?
The IUPAC name of 1-[5-(2-methoxyethyl)-1,2,4-oxadiazol-3-yl]ethanamine (CID 62589330) is 1-[5-(2-methoxyethyl)-1,2,4-oxadiazol-3-yl]ethanamine.
What is the SMILES notation for 1-[5-(2-methoxyethyl)-1,2,4-oxadiazol-3-yl]ethanamine?
The canonical SMILES for 1-[5-(2-methoxyethyl)-1,2,4-oxadiazol-3-yl]ethanamine is COCCc1nc(C(C)N)no1.
What is the InChIKey of 1-[5-(2-methoxyethyl)-1,2,4-oxadiazol-3-yl]ethanamine?
The InChIKey is MAQJERLKVJKWAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O2/c1-5(8)7-9-6(12-10-7)3-4-11-2/h5H,3-4,8H2,1-2H3.
What are the key properties of 1-[5-(2-methoxyethyl)-1,2,4-oxadiazol-3-yl]ethanamine?
1-[5-(2-methoxyethyl)-1,2,4-oxadiazol-3-yl]ethanamine has a molecular weight of 171.20 g/mol, XLogP of 0.28, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(2-methoxyethyl)-1,2,4-oxadiazol-3-yl]ethanamine is sourced from PubChem (CID 62589330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).