About 1-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl]piperidine-4-carbaldehyde
1-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl]piperidine-4-carbaldehyde (PubChem CID 62654121) has the molecular formula C13H15N3O2S
and a molecular weight of 277.35 g/mol. Its IUPAC name is 1-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl]piperidine-4-carbaldehyde.
Molecular Properties
| Compound Name | 1-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl]piperidine-4-carbaldehyde |
| PubChem CID | 62654121 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 1-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl]piperidine-4-carbaldehyde |
| SMILES | O=CC1CCN(Cc2noc(-c3ccsc3)n2)CC1 |
| InChI | InChI=1S/C13H15N3O2S/c17-8-10-1-4-16(5-2-10)7-12-14-13(18-15-12)11-3-6-19-9-11/h3,6,8-10H,1-2,4-5,7H2 |
| InChIKey | PSEHMUDFBSAVNY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl]piperidine-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl]piperidine-4-carbaldehyde?
The IUPAC name of 1-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl]piperidine-4-carbaldehyde (CID 62654121) is 1-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl]piperidine-4-carbaldehyde.
What is the SMILES notation for 1-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl]piperidine-4-carbaldehyde?
The canonical SMILES for 1-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl]piperidine-4-carbaldehyde is O=CC1CCN(Cc2noc(-c3ccsc3)n2)CC1.
What is the InChIKey of 1-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl]piperidine-4-carbaldehyde?
The InChIKey is PSEHMUDFBSAVNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O2S/c17-8-10-1-4-16(5-2-10)7-12-14-13(18-15-12)11-3-6-19-9-11/h3,6,8-10H,1-2,4-5,7H2.
What are the key properties of 1-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl]piperidine-4-carbaldehyde?
1-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl]piperidine-4-carbaldehyde has a molecular weight of 277.35 g/mol, XLogP of 2.21, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl]piperidine-4-carbaldehyde is sourced from PubChem (CID 62654121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).