C13H15N3O2S — CID 62654121
1-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl]piperidine-4-carbaldehyde (PubChem CID 62654121) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 1-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl]piperidine-4-carbaldehyde.
| Compound Name | 1-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 62654121 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 1-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl]piperidine-4-carbaldehyde |
| SMILES | O=CC1CCN(Cc2noc(-c3ccsc3)n2)CC1 |
| InChI | InChI=1S/C13H15N3O2S/c17-8-10-1-4-16(5-2-10)7-12-14-13(18-15-12)11-3-6-19-9-11/h3,6,8-10H,1-2,4-5,7H2 |
| InChIKey | PSEHMUDFBSAVNY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|