C10H17N5O2 — CID 62663587
6-[2-(cyclopropylamino)ethylamino]-2,4-dimethyl-1,2,4-triazine-3,5-dione (PubChem CID 62663587) has the molecular formula C10H17N5O2 and a molecular weight of 239.28 g/mol. Its IUPAC name is 6-[2-(cyclopropylamino)ethylamino]-2,4-dimethyl-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[2-(cyclopropylamino)ethylamino]-2,4-dimethyl-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 62663587 |
| Molecular Formula | C10H17N5O2 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 6-[2-(cyclopropylamino)ethylamino]-2,4-dimethyl-1,2,4-triazine-3,5-dione |
| SMILES | Cn1nc(NCCNC2CC2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C10H17N5O2/c1-14-9(16)8(13-15(2)10(14)17)12-6-5-11-7-3-4-7/h7,11H,3-6H2,1-2H3,(H,12,13) |
| InChIKey | XIPAKJPDIMRSLP-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|