C15H23NO2 — CID 62679186
N-benzyl-N-(2-hydroxyethyl)-2,2-dimethylbutanamide (PubChem CID 62679186) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is N-benzyl-N-(2-hydroxyethyl)-2,2-dimethylbutanamide.
| Compound Name | N-benzyl-N-(2-hydroxyethyl)-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 62679186 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | N-benzyl-N-(2-hydroxyethyl)-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C15H23NO2/c1-4-15(2,3)14(18)16(10-11-17)12-13-8-6-5-7-9-13/h5-9,17H,4,10-12H2,1-3H3 |
| InChIKey | ZFOXQCNCTTWTBE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |