C12H14N4 — CID 62694901
2-(4-cyclopropyl-1,2,4-triazol-3-yl)-6-methylaniline (PubChem CID 62694901) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is 2-(4-cyclopropyl-1,2,4-triazol-3-yl)-6-methylaniline.
| Compound Name | 2-(4-cyclopropyl-1,2,4-triazol-3-yl)-6-methylaniline |
|---|---|
| PubChem CID | 62694901 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 2-(4-cyclopropyl-1,2,4-triazol-3-yl)-6-methylaniline |
| SMILES | Cc1cccc(-c2nncn2C2CC2)c1N |
| InChI | InChI=1S/C12H14N4/c1-8-3-2-4-10(11(8)13)12-15-14-7-16(12)9-5-6-9/h2-4,7,9H,5-6,13H2,1H3 |
| InChIKey | QXNFVCNGMLXRMG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|