C11H9Br2N3 — CID 107944051
4-cyclopropyl-3-(2,4-dibromophenyl)-1,2,4-triazole (PubChem CID 107944051) has the molecular formula C11H9Br2N3 and a molecular weight of 343.02 g/mol. Its IUPAC name is 4-cyclopropyl-3-(2,4-dibromophenyl)-1,2,4-triazole.
| Compound Name | 4-cyclopropyl-3-(2,4-dibromophenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 107944051 |
| Molecular Formula | C11H9Br2N3 |
| Molecular Weight | 343.02 g/mol |
| Exact Mass | 340.92 |
| IUPAC Name | 4-cyclopropyl-3-(2,4-dibromophenyl)-1,2,4-triazole |
| SMILES | Brc1ccc(-c2nncn2C2CC2)c(Br)c1 |
| InChI | InChI=1S/C11H9Br2N3/c12-7-1-4-9(10(13)5-7)11-15-14-6-16(11)8-2-3-8/h1,4-6,8H,2-3H2 |
| InChIKey | SLNMUIYLMHHOGA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.02 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |