About 3-(4-cyclopropyl-1,2,4-triazol-3-yl)-4-fluoroaniline
3-(4-cyclopropyl-1,2,4-triazol-3-yl)-4-fluoroaniline (PubChem CID 62696432) has the molecular formula C11H11FN4
and a molecular weight of 218.24 g/mol. Its IUPAC name is 3-(4-cyclopropyl-1,2,4-triazol-3-yl)-4-fluoroaniline.
Molecular Properties
| Compound Name | 3-(4-cyclopropyl-1,2,4-triazol-3-yl)-4-fluoroaniline |
| PubChem CID | 62696432 |
| Molecular Formula | C11H11FN4 |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | 3-(4-cyclopropyl-1,2,4-triazol-3-yl)-4-fluoroaniline |
| SMILES | Nc1ccc(F)c(-c2nncn2C2CC2)c1 |
| InChI | InChI=1S/C11H11FN4/c12-10-4-1-7(13)5-9(10)11-15-14-6-16(11)8-2-3-8/h1,4-6,8H,2-3,13H2 |
| InChIKey | KBFJCYVAOJPZPX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-cyclopropyl-1,2,4-triazol-3-yl)-4-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-cyclopropyl-1,2,4-triazol-3-yl)-4-fluoroaniline?
The IUPAC name of 3-(4-cyclopropyl-1,2,4-triazol-3-yl)-4-fluoroaniline (CID 62696432) is 3-(4-cyclopropyl-1,2,4-triazol-3-yl)-4-fluoroaniline.
What is the SMILES notation for 3-(4-cyclopropyl-1,2,4-triazol-3-yl)-4-fluoroaniline?
The canonical SMILES for 3-(4-cyclopropyl-1,2,4-triazol-3-yl)-4-fluoroaniline is Nc1ccc(F)c(-c2nncn2C2CC2)c1.
What is the InChIKey of 3-(4-cyclopropyl-1,2,4-triazol-3-yl)-4-fluoroaniline?
The InChIKey is KBFJCYVAOJPZPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FN4/c12-10-4-1-7(13)5-9(10)11-15-14-6-16(11)8-2-3-8/h1,4-6,8H,2-3,13H2.
What are the key properties of 3-(4-cyclopropyl-1,2,4-triazol-3-yl)-4-fluoroaniline?
3-(4-cyclopropyl-1,2,4-triazol-3-yl)-4-fluoroaniline has a molecular weight of 218.24 g/mol, XLogP of 2.00, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-cyclopropyl-1,2,4-triazol-3-yl)-4-fluoroaniline is sourced from PubChem (CID 62696432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).