C22H26ClN — CID 62706754
(2S,3R,4S)-1-benzyl-4-(4-chlorophenyl)-2-methyl-3-prop-2-enylpiperidine (PubChem CID 62706754) has the molecular formula C22H26ClN and a molecular weight of 339.91 g/mol. Its IUPAC name is (2S,3R,4S)-1-benzyl-4-(4-chlorophenyl)-2-methyl-3-prop-2-enylpiperidine.
| Compound Name | (2S,3R,4S)-1-benzyl-4-(4-chlorophenyl)-2-methyl-3-prop-2-enylpiperidine |
|---|---|
| PubChem CID | 62706754 |
| Molecular Formula | C22H26ClN |
| Molecular Weight | 339.91 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (2S,3R,4S)-1-benzyl-4-(4-chlorophenyl)-2-methyl-3-prop-2-enylpiperidine |
| SMILES | C=CC[C@@H]1[C@@H](c2ccc(Cl)cc2)CCN(Cc2ccccc2)[C@H]1C |
| InChI | InChI=1S/C22H26ClN/c1-3-7-21-17(2)24(16-18-8-5-4-6-9-18)15-14-22(21)19-10-12-20(23)13-11-19/h3-6,8-13,17,21-22H,1,7,14-16H2,2H3/t17-,21-,22+/m0/s1 |
| InChIKey | HHIBXCCHWDOCKF-BULFRSBZSA-N |
| XLogP | 5.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.91 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|