C13H15NO6 — CID 62707467
5-(hydroperoxymethyl)-2-(3,4,5-trimethoxyphenyl)-1,3-oxazole (PubChem CID 62707467) has the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. Its IUPAC name is 5-(hydroperoxymethyl)-2-(3,4,5-trimethoxyphenyl)-1,3-oxazole.
| Compound Name | 5-(hydroperoxymethyl)-2-(3,4,5-trimethoxyphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 62707467 |
| Molecular Formula | C13H15NO6 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 5-(hydroperoxymethyl)-2-(3,4,5-trimethoxyphenyl)-1,3-oxazole |
| SMILES | COc1cc(-c2ncc(COO)o2)cc(OC)c1OC |
| InChI | InChI=1S/C13H15NO6/c1-16-10-4-8(5-11(17-2)12(10)18-3)13-14-6-9(20-13)7-19-15/h4-6,15H,7H2,1-3H3 |
| InChIKey | WJSLSLUKZDMJFV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 83.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|