C18H17NO4Se — CID 141346853
4-[5-(3,4,5-trimethoxyphenyl)-1,3-selenazol-4-yl]phenol (PubChem CID 141346853) has the molecular formula C18H17NO4Se and a molecular weight of 390.30 g/mol. Its IUPAC name is 4-[5-(3,4,5-trimethoxyphenyl)-1,3-selenazol-4-yl]phenol.
| Compound Name | 4-[5-(3,4,5-trimethoxyphenyl)-1,3-selenazol-4-yl]phenol |
|---|---|
| PubChem CID | 141346853 |
| Molecular Formula | C18H17NO4Se |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | 4-[5-(3,4,5-trimethoxyphenyl)-1,3-selenazol-4-yl]phenol |
| SMILES | COc1cc(-c2[se]cnc2-c2ccc(O)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C18H17NO4Se/c1-21-14-8-12(9-15(22-2)17(14)23-3)18-16(19-10-24-18)11-4-6-13(20)7-5-11/h4-10,20H,1-3H3 |
| InChIKey | IIKVZAFNPKNUQA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|