C14H20F3N3S — CID 62750176
2-N-cyclopropyl-5,5-dimethyl-2-N-(2,2,2-trifluoroethyl)-6,7-dihydro-4H-1,3-benzothiazole-2,7-diamine (PubChem CID 62750176) has the molecular formula C14H20F3N3S and a molecular weight of 319.40 g/mol. Its IUPAC name is 2-N-cyclopropyl-5,5-dimethyl-2-N-(2,2,2-trifluoroethyl)-6,7-dihydro-4H-1,3-benzothiazole-2,7-diamine.
| Compound Name | 2-N-cyclopropyl-5,5-dimethyl-2-N-(2,2,2-trifluoroethyl)-6,7-dihydro-4H-1,3-benzothiazole-2,7-diamine |
|---|---|
| PubChem CID | 62750176 |
| Molecular Formula | C14H20F3N3S |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 2-N-cyclopropyl-5,5-dimethyl-2-N-(2,2,2-trifluoroethyl)-6,7-dihydro-4H-1,3-benzothiazole-2,7-diamine |
| SMILES | CC1(C)Cc2nc(N(CC(F)(F)F)C3CC3)sc2C(N)C1 |
| InChI | InChI=1S/C14H20F3N3S/c1-13(2)5-9(18)11-10(6-13)19-12(21-11)20(8-3-4-8)7-14(15,16)17/h8-9H,3-7,18H2,1-2H3 |
| InChIKey | SSVKQWLZRWQZMA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |