C29H33N3O4 — CID 6278855
1-[(Z)-[4-[2-(4-cyclohexylphenoxy)ethoxy]-3-methoxyphenyl]methylideneamino]-3-phenylurea (PubChem CID 6278855) has the molecular formula C29H33N3O4 and a molecular weight of 487.60 g/mol. Its IUPAC name is 1-[(Z)-[4-[2-(4-cyclohexylphenoxy)ethoxy]-3-methoxyphenyl]methylideneamino]-3-phenylurea.
| Compound Name | 1-[(Z)-[4-[2-(4-cyclohexylphenoxy)ethoxy]-3-methoxyphenyl]methylideneamino]-3-phenylurea |
|---|---|
| PubChem CID | 6278855 |
| Molecular Formula | C29H33N3O4 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | 1-[(Z)-[4-[2-(4-cyclohexylphenoxy)ethoxy]-3-methoxyphenyl]methylideneamino]-3-phenylurea |
| SMILES | COc1cc(/C=N\NC(=O)Nc2ccccc2)ccc1OCCOc1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C29H33N3O4/c1-34-28-20-22(21-30-32-29(33)31-25-10-6-3-7-11-25)12-17-27(28)36-19-18-35-26-15-13-24(14-16-26)23-8-4-2-5-9-23/h3,6-7,10-17,20-21,23H,2,4-5,8-9,18-19H2,1H3,(H2,31,32,33)/b30-21- |
| InChIKey | NDINGKLGNQSUEY-OFWBYEQRSA-N |
| XLogP | 6.36 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|