C10H8ClF3N2O2 — CID 62811714
2-chloro-N-[(3,4,5-trifluorophenyl)carbamoyl]propanamide (PubChem CID 62811714) has the molecular formula C10H8ClF3N2O2 and a molecular weight of 280.63 g/mol. Its IUPAC name is 2-chloro-N-[(3,4,5-trifluorophenyl)carbamoyl]propanamide.
| Compound Name | 2-chloro-N-[(3,4,5-trifluorophenyl)carbamoyl]propanamide |
|---|---|
| PubChem CID | 62811714 |
| Molecular Formula | C10H8ClF3N2O2 |
| Molecular Weight | 280.63 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | 2-chloro-N-[(3,4,5-trifluorophenyl)carbamoyl]propanamide |
| SMILES | CC(Cl)C(=O)NC(=O)Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C10H8ClF3N2O2/c1-4(11)9(17)16-10(18)15-5-2-6(12)8(14)7(13)3-5/h2-4H,1H3,(H2,15,16,17,18) |
| InChIKey | YGZZFLFXQYGYJV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.63 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|