C12H21N3O — CID 62832866
N-[(1,5-dimethylpyrrol-2-yl)methyl]-3-(ethylamino)propanamide (PubChem CID 62832866) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is N-[(1,5-dimethylpyrrol-2-yl)methyl]-3-(ethylamino)propanamide.
| Compound Name | N-[(1,5-dimethylpyrrol-2-yl)methyl]-3-(ethylamino)propanamide |
|---|---|
| PubChem CID | 62832866 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | N-[(1,5-dimethylpyrrol-2-yl)methyl]-3-(ethylamino)propanamide |
| SMILES | CCNCCC(=O)NCc1ccc(C)n1C |
| InChI | InChI=1S/C12H21N3O/c1-4-13-8-7-12(16)14-9-11-6-5-10(2)15(11)3/h5-6,13H,4,7-9H2,1-3H3,(H,14,16) |
| InChIKey | DDLMVPJJDYMZTH-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|