C8H8ClN5S2 — CID 62866519
4-chloro-N,N-dimethyl-6-(1,3-thiazol-2-ylsulfanyl)-1,3,5-triazin-2-amine (PubChem CID 62866519) has the molecular formula C8H8ClN5S2 and a molecular weight of 273.77 g/mol. Its IUPAC name is 4-chloro-N,N-dimethyl-6-(1,3-thiazol-2-ylsulfanyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N,N-dimethyl-6-(1,3-thiazol-2-ylsulfanyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 62866519 |
| Molecular Formula | C8H8ClN5S2 |
| Molecular Weight | 273.77 g/mol |
| Exact Mass | 272.99 |
| IUPAC Name | 4-chloro-N,N-dimethyl-6-(1,3-thiazol-2-ylsulfanyl)-1,3,5-triazin-2-amine |
| SMILES | CN(C)c1nc(Cl)nc(Sc2nccs2)n1 |
| InChI | InChI=1S/C8H8ClN5S2/c1-14(2)6-11-5(9)12-7(13-6)16-8-10-3-4-15-8/h3-4H,1-2H3 |
| InChIKey | BOLMGQJORAWDOE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 54.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.77 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|