C14H15N3O3S — CID 62884193
3-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-2-phenylpropanoic acid (PubChem CID 62884193) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 3-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-2-phenylpropanoic acid.
| Compound Name | 3-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 62884193 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 3-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-2-phenylpropanoic acid |
| SMILES | Nc1nc(CC(=O)NCC(C(=O)O)c2ccccc2)cs1 |
| InChI | InChI=1S/C14H15N3O3S/c15-14-17-10(8-21-14)6-12(18)16-7-11(13(19)20)9-4-2-1-3-5-9/h1-5,8,11H,6-7H2,(H2,15,17)(H,16,18)(H,19,20) |
| InChIKey | IYROUUGUOMZQJW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |