C10H11Cl2NO2S — CID 62887403
ethyl 2-[(3,6-dichloro-2-pyridinyl)methylsulfanyl]acetate (PubChem CID 62887403) has the molecular formula C10H11Cl2NO2S and a molecular weight of 280.18 g/mol. Its IUPAC name is ethyl 2-[(3,6-dichloro-2-pyridinyl)methylsulfanyl]acetate.
| Compound Name | ethyl 2-[(3,6-dichloro-2-pyridinyl)methylsulfanyl]acetate |
|---|---|
| PubChem CID | 62887403 |
| Molecular Formula | C10H11Cl2NO2S |
| Molecular Weight | 280.18 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | ethyl 2-[(3,6-dichloro-2-pyridinyl)methylsulfanyl]acetate |
| SMILES | CCOC(=O)CSCc1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C10H11Cl2NO2S/c1-2-15-10(14)6-16-5-8-7(11)3-4-9(12)13-8/h3-4H,2,5-6H2,1H3 |
| InChIKey | NPPLPUYPDHRSER-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.18 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|