C11H21N3O3 — CID 62901402
2-[4-(1-amino-1-oxobutan-2-yl)-1,4-diazepan-1-yl]acetic acid (PubChem CID 62901402) has the molecular formula C11H21N3O3 and a molecular weight of 243.31 g/mol. Its IUPAC name is 2-[4-(1-amino-1-oxobutan-2-yl)-1,4-diazepan-1-yl]acetic acid.
| Compound Name | 2-[4-(1-amino-1-oxobutan-2-yl)-1,4-diazepan-1-yl]acetic acid |
|---|---|
| PubChem CID | 62901402 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 2-[4-(1-amino-1-oxobutan-2-yl)-1,4-diazepan-1-yl]acetic acid |
| SMILES | CCC(C(N)=O)N1CCCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C11H21N3O3/c1-2-9(11(12)17)14-5-3-4-13(6-7-14)8-10(15)16/h9H,2-8H2,1H3,(H2,12,17)(H,15,16) |
| InChIKey | VJJJUUOHSOPHEJ-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |