C20H35N5O9 — CID 15838489
2-[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]butanoylamino]acetic acid (PubChem CID 15838489) has the molecular formula C20H35N5O9 and a molecular weight of 489.53 g/mol. Its IUPAC name is 2-[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]butanoylamino]acetic acid.
| Compound Name | 2-[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]butanoylamino]acetic acid |
|---|---|
| PubChem CID | 15838489 |
| Molecular Formula | C20H35N5O9 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 2-[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]butanoylamino]acetic acid |
| SMILES | CCC(C(=O)NCC(=O)O)N1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C20H35N5O9/c1-2-15(20(34)21-11-16(26)27)25-9-7-23(13-18(30)31)5-3-22(12-17(28)29)4-6-24(8-10-25)14-19(32)33/h15H,2-14H2,1H3,(H,21,34)(H,26,27)(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | NZMWZHYVJQZVBT-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 191.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |