C6H8N2O5S — CID 62904166
3-(1,2-oxazol-4-ylsulfamoyl)propanoic acid (PubChem CID 62904166) has the molecular formula C6H8N2O5S and a molecular weight of 220.21 g/mol. Its IUPAC name is 3-(1,2-oxazol-4-ylsulfamoyl)propanoic acid.
| Compound Name | 3-(1,2-oxazol-4-ylsulfamoyl)propanoic acid |
|---|---|
| PubChem CID | 62904166 |
| Molecular Formula | C6H8N2O5S |
| Molecular Weight | 220.21 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 3-(1,2-oxazol-4-ylsulfamoyl)propanoic acid |
| SMILES | O=C(O)CCS(=O)(=O)Nc1cnoc1 |
| InChI | InChI=1S/C6H8N2O5S/c9-6(10)1-2-14(11,12)8-5-3-7-13-4-5/h3-4,8H,1-2H2,(H,9,10) |
| InChIKey | CWQVXXVXEXORSJ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.21 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |