C18H13ClN4O6 — CID 6290881
4-[[2-[(2Z)-2-[(Z)-2-chloro-3-(4-nitrophenyl)prop-2-enylidene]hydrazinyl]-2-oxoacetyl]amino]benzoic acid (PubChem CID 6290881) has the molecular formula C18H13ClN4O6 and a molecular weight of 416.78 g/mol. Its IUPAC name is 4-[[2-[(2Z)-2-[(Z)-2-chloro-3-(4-nitrophenyl)prop-2-enylidene]hydrazinyl]-2-oxoacetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[(2Z)-2-[(Z)-2-chloro-3-(4-nitrophenyl)prop-2-enylidene]hydrazinyl]-2-oxoacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 6290881 |
| Molecular Formula | C18H13ClN4O6 |
| Molecular Weight | 416.78 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 4-[[2-[(2Z)-2-[(Z)-2-chloro-3-(4-nitrophenyl)prop-2-enylidene]hydrazinyl]-2-oxoacetyl]amino]benzoic acid |
| SMILES | O=C(N/N=C\C(Cl)=C\c1ccc([N+](=O)[O-])cc1)C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C18H13ClN4O6/c19-13(9-11-1-7-15(8-2-11)23(28)29)10-20-22-17(25)16(24)21-14-5-3-12(4-6-14)18(26)27/h1-10H,(H,21,24)(H,22,25)(H,26,27)/b13-9-,20-10- |
| InChIKey | VAZSWYMUYICMRR-DAIOXCCDSA-N |
| XLogP | 2.61 |
| TPSA | 151.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.78 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|