C11H14N4O4S2 — CID 62921929
2-[(2-amino-2-oxoethyl)-(2-carbamothioylphenyl)sulfonylamino]acetamide (PubChem CID 62921929) has the molecular formula C11H14N4O4S2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-(2-carbamothioylphenyl)sulfonylamino]acetamide.
| Compound Name | 2-[(2-amino-2-oxoethyl)-(2-carbamothioylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 62921929 |
| Molecular Formula | C11H14N4O4S2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-(2-carbamothioylphenyl)sulfonylamino]acetamide |
| SMILES | NC(=O)CN(CC(N)=O)S(=O)(=O)c1ccccc1C(N)=S |
| InChI | InChI=1S/C11H14N4O4S2/c12-9(16)5-15(6-10(13)17)21(18,19)8-4-2-1-3-7(8)11(14)20/h1-4H,5-6H2,(H2,12,16)(H2,13,17)(H2,14,20) |
| InChIKey | QUWDMDUWXQDGAL-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 149.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|