C24H14N2O3 — CID 629442
5-phenyl-4-(3-phenylquinoxalin-2-yl)furan-2,3-dione (PubChem CID 629442) has the molecular formula C24H14N2O3 and a molecular weight of 378.39 g/mol. Its IUPAC name is 5-phenyl-4-(3-phenylquinoxalin-2-yl)furan-2,3-dione.
| Compound Name | 5-phenyl-4-(3-phenylquinoxalin-2-yl)furan-2,3-dione |
|---|---|
| PubChem CID | 629442 |
| Molecular Formula | C24H14N2O3 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 5-phenyl-4-(3-phenylquinoxalin-2-yl)furan-2,3-dione |
| SMILES | O=C1OC(c2ccccc2)=C(c2nc3ccccc3nc2-c2ccccc2)C1=O |
| InChI | InChI=1S/C24H14N2O3/c27-22-19(23(29-24(22)28)16-11-5-2-6-12-16)21-20(15-9-3-1-4-10-15)25-17-13-7-8-14-18(17)26-21/h1-14H |
| InChIKey | RPUUHJNMJWXIBO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_fives(89)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|