C9H9N5O4S — CID 62946479
1-(2-nitrophenyl)-N-(1H-1,2,4-triazol-5-yl)methanesulfonamide (PubChem CID 62946479) has the molecular formula C9H9N5O4S and a molecular weight of 283.27 g/mol. Its IUPAC name is 1-(2-nitrophenyl)-N-(1H-1,2,4-triazol-5-yl)methanesulfonamide.
| Compound Name | 1-(2-nitrophenyl)-N-(1H-1,2,4-triazol-5-yl)methanesulfonamide |
|---|---|
| PubChem CID | 62946479 |
| Molecular Formula | C9H9N5O4S |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 1-(2-nitrophenyl)-N-(1H-1,2,4-triazol-5-yl)methanesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1CS(=O)(=O)Nc1ncn[nH]1 |
| InChI | InChI=1S/C9H9N5O4S/c15-14(16)8-4-2-1-3-7(8)5-19(17,18)13-9-10-6-11-12-9/h1-4,6H,5H2,(H2,10,11,12,13) |
| InChIKey | UMGULMBTKQULJI-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|