C11H9N3O6S2 — CID 86567421
5-[(2-nitrophenyl)methylsulfonylamino]-1,3-thiazole-4-carboxylic acid (PubChem CID 86567421) has the molecular formula C11H9N3O6S2 and a molecular weight of 343.34 g/mol. Its IUPAC name is 5-[(2-nitrophenyl)methylsulfonylamino]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-[(2-nitrophenyl)methylsulfonylamino]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 86567421 |
| Molecular Formula | C11H9N3O6S2 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | 5-[(2-nitrophenyl)methylsulfonylamino]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1ncsc1NS(=O)(=O)Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H9N3O6S2/c15-11(16)9-10(21-6-12-9)13-22(19,20)5-7-3-1-2-4-8(7)14(17)18/h1-4,6,13H,5H2,(H,15,16) |
| InChIKey | DYLJXXDAMLCUHT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 139.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|