C9H15N5OS — CID 62950345
N-butan-2-yl-2-(3-carbamothioyl-1,2,4-triazol-1-yl)acetamide (PubChem CID 62950345) has the molecular formula C9H15N5OS and a molecular weight of 241.32 g/mol. Its IUPAC name is N-butan-2-yl-2-(3-carbamothioyl-1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-butan-2-yl-2-(3-carbamothioyl-1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 62950345 |
| Molecular Formula | C9H15N5OS |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | N-butan-2-yl-2-(3-carbamothioyl-1,2,4-triazol-1-yl)acetamide |
| SMILES | CCC(C)NC(=O)Cn1cnc(C(N)=S)n1 |
| InChI | InChI=1S/C9H15N5OS/c1-3-6(2)12-7(15)4-14-5-11-9(13-14)8(10)16/h5-6H,3-4H2,1-2H3,(H2,10,16)(H,12,15) |
| InChIKey | RBGXZEGWVSZQIC-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|