C13H15F2N3OS — CID 62956599
1-(2-carbamothioylcyclopentyl)-3-(2,4-difluorophenyl)urea (PubChem CID 62956599) has the molecular formula C13H15F2N3OS and a molecular weight of 299.35 g/mol. Its IUPAC name is 1-(2-carbamothioylcyclopentyl)-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-(2-carbamothioylcyclopentyl)-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 62956599 |
| Molecular Formula | C13H15F2N3OS |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 1-(2-carbamothioylcyclopentyl)-3-(2,4-difluorophenyl)urea |
| SMILES | NC(=S)C1CCCC1NC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C13H15F2N3OS/c14-7-4-5-11(9(15)6-7)18-13(19)17-10-3-1-2-8(10)12(16)20/h4-6,8,10H,1-3H2,(H2,16,20)(H2,17,18,19) |
| InChIKey | HGEQHWRQOFNTIM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|