C7H10N6S — CID 62962458
4-ethyl-N-(2H-tetrazol-5-ylmethyl)-1,3-thiazol-2-amine (PubChem CID 62962458) has the molecular formula C7H10N6S and a molecular weight of 210.27 g/mol. Its IUPAC name is 4-ethyl-N-(2H-tetrazol-5-ylmethyl)-1,3-thiazol-2-amine.
| Compound Name | 4-ethyl-N-(2H-tetrazol-5-ylmethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 62962458 |
| Molecular Formula | C7H10N6S |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 4-ethyl-N-(2H-tetrazol-5-ylmethyl)-1,3-thiazol-2-amine |
| SMILES | CCc1csc(NCc2nn[nH]n2)n1 |
| InChI | InChI=1S/C7H10N6S/c1-2-5-4-14-7(9-5)8-3-6-10-12-13-11-6/h4H,2-3H2,1H3,(H,8,9)(H,10,11,12,13) |
| InChIKey | CMPXIOZDVLKFCK-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |