C10H12N4S — CID 106832833
4-ethyl-N-(pyridazin-3-ylmethyl)-1,3-thiazol-2-amine (PubChem CID 106832833) has the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. Its IUPAC name is 4-ethyl-N-(pyridazin-3-ylmethyl)-1,3-thiazol-2-amine.
| Compound Name | 4-ethyl-N-(pyridazin-3-ylmethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 106832833 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 4-ethyl-N-(pyridazin-3-ylmethyl)-1,3-thiazol-2-amine |
| SMILES | CCc1csc(NCc2cccnn2)n1 |
| InChI | InChI=1S/C10H12N4S/c1-2-8-7-15-10(13-8)11-6-9-4-3-5-12-14-9/h3-5,7H,2,6H2,1H3,(H,11,13) |
| InChIKey | UDPJHATXTWWVOR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |