C11H16N2O2 — CID 62973119
[4-(1,4-oxazepan-4-yl)-2-pyridinyl]methanol (PubChem CID 62973119) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is [4-(1,4-oxazepan-4-yl)-2-pyridinyl]methanol.
| Compound Name | [4-(1,4-oxazepan-4-yl)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 62973119 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | [4-(1,4-oxazepan-4-yl)-2-pyridinyl]methanol |
| SMILES | OCc1cc(N2CCCOCC2)ccn1 |
| InChI | InChI=1S/C11H16N2O2/c14-9-10-8-11(2-3-12-10)13-4-1-6-15-7-5-13/h2-3,8,14H,1,4-7,9H2 |
| InChIKey | XJUMYVZOYQNXJD-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |