C11H14N2O — CID 114412365
[4-(3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methanol (PubChem CID 114412365) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is [4-(3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methanol.
| Compound Name | [4-(3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 114412365 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | [4-(3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methanol |
| SMILES | OCc1cc(N2CC=CCC2)ccn1 |
| InChI | InChI=1S/C11H14N2O/c14-9-10-8-11(4-5-12-10)13-6-2-1-3-7-13/h1-2,4-5,8,14H,3,6-7,9H2 |
| InChIKey | FTWZMQAQDOPXOV-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|