C11H17NOS2 — CID 62994820
2-(oxan-4-ylsulfanyl)-2-thiophen-3-ylethanamine (PubChem CID 62994820) has the molecular formula C11H17NOS2 and a molecular weight of 243.40 g/mol. Its IUPAC name is 2-(oxan-4-ylsulfanyl)-2-thiophen-3-ylethanamine.
| Compound Name | 2-(oxan-4-ylsulfanyl)-2-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 62994820 |
| Molecular Formula | C11H17NOS2 |
| Molecular Weight | 243.40 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 2-(oxan-4-ylsulfanyl)-2-thiophen-3-ylethanamine |
| SMILES | NCC(SC1CCOCC1)c1ccsc1 |
| InChI | InChI=1S/C11H17NOS2/c12-7-11(9-3-6-14-8-9)15-10-1-4-13-5-2-10/h3,6,8,10-11H,1-2,4-5,7,12H2 |
| InChIKey | NBCQPSDBZGORMQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |