C10H15N3O5S — CID 62996048
1-[2-(oxan-4-ylsulfonyl)ethyl]triazole-4-carboxylic acid (PubChem CID 62996048) has the molecular formula C10H15N3O5S and a molecular weight of 289.31 g/mol. Its IUPAC name is 1-[2-(oxan-4-ylsulfonyl)ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-(oxan-4-ylsulfonyl)ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 62996048 |
| Molecular Formula | C10H15N3O5S |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 1-[2-(oxan-4-ylsulfonyl)ethyl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(CCS(=O)(=O)C2CCOCC2)nn1 |
| InChI | InChI=1S/C10H15N3O5S/c14-10(15)9-7-13(12-11-9)3-6-19(16,17)8-1-4-18-5-2-8/h7-8H,1-6H2,(H,14,15) |
| InChIKey | KMFIYOXFBKNSLE-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |