C15H21N3O3 — CID 63022785
5-[(4-aminopiperidine-1-carbonyl)amino]-2,3-dimethylbenzoic acid (PubChem CID 63022785) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 5-[(4-aminopiperidine-1-carbonyl)amino]-2,3-dimethylbenzoic acid.
| Compound Name | 5-[(4-aminopiperidine-1-carbonyl)amino]-2,3-dimethylbenzoic acid |
|---|---|
| PubChem CID | 63022785 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 5-[(4-aminopiperidine-1-carbonyl)amino]-2,3-dimethylbenzoic acid |
| SMILES | Cc1cc(NC(=O)N2CCC(N)CC2)cc(C(=O)O)c1C |
| InChI | InChI=1S/C15H21N3O3/c1-9-7-12(8-13(10(9)2)14(19)20)17-15(21)18-5-3-11(16)4-6-18/h7-8,11H,3-6,16H2,1-2H3,(H,17,21)(H,19,20) |
| InChIKey | OMTFETDQZMDEQM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |