C10H8ClN3O3S2 — CID 63023211
N-(3-chloro-4-sulfamoylphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 63023211) has the molecular formula C10H8ClN3O3S2 and a molecular weight of 317.78 g/mol. Its IUPAC name is N-(3-chloro-4-sulfamoylphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(3-chloro-4-sulfamoylphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 63023211 |
| Molecular Formula | C10H8ClN3O3S2 |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 316.97 |
| IUPAC Name | N-(3-chloro-4-sulfamoylphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2cscn2)cc1Cl |
| InChI | InChI=1S/C10H8ClN3O3S2/c11-7-3-6(1-2-9(7)19(12,16)17)14-10(15)8-4-18-5-13-8/h1-5H,(H,14,15)(H2,12,16,17) |
| InChIKey | NZOYMZSPWYDRHL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |