C13H16N4O — CID 63027158
3-piperidin-3-yl-5-(pyridin-4-ylmethyl)-1,2,4-oxadiazole (PubChem CID 63027158) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 3-piperidin-3-yl-5-(pyridin-4-ylmethyl)-1,2,4-oxadiazole.
| Compound Name | 3-piperidin-3-yl-5-(pyridin-4-ylmethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 63027158 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 3-piperidin-3-yl-5-(pyridin-4-ylmethyl)-1,2,4-oxadiazole |
| SMILES | c1cc(Cc2nc(C3CCCNC3)no2)ccn1 |
| InChI | InChI=1S/C13H16N4O/c1-2-11(9-15-5-1)13-16-12(18-17-13)8-10-3-6-14-7-4-10/h3-4,6-7,11,15H,1-2,5,8-9H2 |
| InChIKey | RWHWDWOOSPOMGN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |