C10H14N2O2S — CID 63037211
N-methyl-N-(oxan-4-yl)-1,3-thiazole-4-carboxamide (PubChem CID 63037211) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is N-methyl-N-(oxan-4-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-methyl-N-(oxan-4-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 63037211 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | N-methyl-N-(oxan-4-yl)-1,3-thiazole-4-carboxamide |
| SMILES | CN(C(=O)c1cscn1)C1CCOCC1 |
| InChI | InChI=1S/C10H14N2O2S/c1-12(8-2-4-14-5-3-8)10(13)9-6-15-7-11-9/h6-8H,2-5H2,1H3 |
| InChIKey | YPIADLFNOKKSOK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |