4-[methyl(oxolan-3-yl)carbamoyl]-1,3-thiazole-2-carboxylic acid

C10H12N2O4S — CID 104892962

IUPAC4-[methyl(oxolan-3-yl)carbamoyl]-1,3-thiazole-2-carboxylic acid
SMILESCN(C(=O)c1csc(C(=O)O)n1)C1CCOC1
InChIInChI=1S/C10H12N2O4S/c1-12(6-2-3-16-4-6)9(13)7-5-17-8(11-7)10(14)15/h5-6H,2-4H2,1H3,(H,14,15)
InChIKeySBMWNECXTHYEJG-UHFFFAOYSA-N
MW256.28 g/mol
LogP0.70
Rot. Bonds3

About 4-[methyl(oxolan-3-yl)carbamoyl]-1,3-thiazole-2-carboxylic acid

4-[methyl(oxolan-3-yl)carbamoyl]-1,3-thiazole-2-carboxylic acid (PubChem CID 104892962) has the molecular formula C10H12N2O4S and a molecular weight of 256.28 g/mol. Its IUPAC name is 4-[methyl(oxolan-3-yl)carbamoyl]-1,3-thiazole-2-carboxylic acid.

Molecular Properties

Compound Name4-[methyl(oxolan-3-yl)carbamoyl]-1,3-thiazole-2-carboxylic acid
PubChem CID104892962
Molecular FormulaC10H12N2O4S
Molecular Weight256.28 g/mol
Exact Mass256.05
IUPAC Name4-[methyl(oxolan-3-yl)carbamoyl]-1,3-thiazole-2-carboxylic acid
SMILESCN(C(=O)c1csc(C(=O)O)n1)C1CCOC1
InChIInChI=1S/C10H12N2O4S/c1-12(6-2-3-16-4-6)9(13)7-5-17-8(11-7)10(14)15/h5-6H,2-4H2,1H3,(H,14,15)
InChIKeySBMWNECXTHYEJG-UHFFFAOYSA-N
XLogP0.70
TPSA79.73 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.28
LogP ≤ 50.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 4-[methyl(oxolan-3-yl)carbamoyl]-1,3-thiazole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[methyl(oxolan-3-yl)carbamoyl]-1,3-thiazole-2-carboxylic acid?
The IUPAC name of 4-[methyl(oxolan-3-yl)carbamoyl]-1,3-thiazole-2-carboxylic acid (CID 104892962) is 4-[methyl(oxolan-3-yl)carbamoyl]-1,3-thiazole-2-carboxylic acid.
What is the SMILES notation for 4-[methyl(oxolan-3-yl)carbamoyl]-1,3-thiazole-2-carboxylic acid?
The canonical SMILES for 4-[methyl(oxolan-3-yl)carbamoyl]-1,3-thiazole-2-carboxylic acid is CN(C(=O)c1csc(C(=O)O)n1)C1CCOC1.
What is the InChIKey of 4-[methyl(oxolan-3-yl)carbamoyl]-1,3-thiazole-2-carboxylic acid?
The InChIKey is SBMWNECXTHYEJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O4S/c1-12(6-2-3-16-4-6)9(13)7-5-17-8(11-7)10(14)15/h5-6H,2-4H2,1H3,(H,14,15).
What are the key properties of 4-[methyl(oxolan-3-yl)carbamoyl]-1,3-thiazole-2-carboxylic acid?
4-[methyl(oxolan-3-yl)carbamoyl]-1,3-thiazole-2-carboxylic acid has a molecular weight of 256.28 g/mol, XLogP of 0.70, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[methyl(oxolan-3-yl)carbamoyl]-1,3-thiazole-2-carboxylic acid is sourced from PubChem (CID 104892962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).