C18H17N3 — CID 63048856
N-cyclopropyl-4,5-diphenyl-1H-pyrazol-3-amine (PubChem CID 63048856) has the molecular formula C18H17N3 and a molecular weight of 275.36 g/mol. Its IUPAC name is N-cyclopropyl-4,5-diphenyl-1H-pyrazol-3-amine.
| Compound Name | N-cyclopropyl-4,5-diphenyl-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 63048856 |
| Molecular Formula | C18H17N3 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | N-cyclopropyl-4,5-diphenyl-1H-pyrazol-3-amine |
| SMILES | c1ccc(-c2[nH]nc(NC3CC3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H17N3/c1-3-7-13(8-4-1)16-17(14-9-5-2-6-10-14)20-21-18(16)19-15-11-12-15/h1-10,15H,11-12H2,(H2,19,20,21) |
| InChIKey | PTFQXEDTOXZSLS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |