C10H17F3O4 — CID 63072935
3-(2-butoxyethoxy)-4,4,4-trifluorobutanoic acid (PubChem CID 63072935) has the molecular formula C10H17F3O4 and a molecular weight of 258.24 g/mol. Its IUPAC name is 3-(2-butoxyethoxy)-4,4,4-trifluorobutanoic acid.
| Compound Name | 3-(2-butoxyethoxy)-4,4,4-trifluorobutanoic acid |
|---|---|
| PubChem CID | 63072935 |
| Molecular Formula | C10H17F3O4 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 3-(2-butoxyethoxy)-4,4,4-trifluorobutanoic acid |
| SMILES | CCCCOCCOC(CC(=O)O)C(F)(F)F |
| InChI | InChI=1S/C10H17F3O4/c1-2-3-4-16-5-6-17-8(7-9(14)15)10(11,12)13/h8H,2-7H2,1H3,(H,14,15) |
| InChIKey | DSKFITYDKBSEQV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|