C11H7F2N3O2 — CID 63076329
4-[bis(cyanomethyl)amino]-3,5-difluorobenzoic acid (PubChem CID 63076329) has the molecular formula C11H7F2N3O2 and a molecular weight of 251.19 g/mol. Its IUPAC name is 4-[bis(cyanomethyl)amino]-3,5-difluorobenzoic acid.
| Compound Name | 4-[bis(cyanomethyl)amino]-3,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 63076329 |
| Molecular Formula | C11H7F2N3O2 |
| Molecular Weight | 251.19 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 4-[bis(cyanomethyl)amino]-3,5-difluorobenzoic acid |
| SMILES | N#CCN(CC#N)c1c(F)cc(C(=O)O)cc1F |
| InChI | InChI=1S/C11H7F2N3O2/c12-8-5-7(11(17)18)6-9(13)10(8)16(3-1-14)4-2-15/h5-6H,3-4H2,(H,17,18) |
| InChIKey | IMXFCIYIFURQCU-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 88.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.19 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|